212844-54-7
Chemical Structure
Purvalanol B
Synonym(s): NG 95
- CAS No.: 212844-54-7
- Formula:C20H25ClN6O3
- Molecular Weight:432.90
IUPAC Name: (R)-2-chloro-4-((2-((1-hydroxy-3-methylbutan-2-yl)amino)-9-isopropyl-9H-purin-6-yl)amino)benzoic acid
InChIKey: ZKDXRFMOHZVXSG-HNNXBMFYSA-N
SMILES: O=C(O)C1=CC=C(NC2=C3N=CN(C(C)C)C3=NC(N[C@@H](CO)C(C)C)=N2)C=C1Cl
Biological Activity: Purvalanol B (NG 95) is a potent, selective, reversible and ATP-competitive inhibitor CDK, with IC50s of 6 nM, 6 nM, 9 nM, 6 nM for cdc2-cyclin B, CDK2-cyclin A, CDK2-cyclin E and CDK5-p35, respectively. Purvalanol B shows selectivity for CDK over a range of other protein kinases (IC50>1000 nM). Purvalanol B inhibits the growth a chloroquine-resistant strain of P. falciparum[1][1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Purvalanol B | 97.0% | Purvalanol B (NG 95) is a potent, selective, reversible and ATP-competitive inhibitor CDK, with IC50s of 6 nM, 6 nM, 9 nM, 6 nM for cdc2-cyclin B, CDK2-cyclin A, CDK2-cyclin E and CDK5-p35, respectively. Purvalanol B shows selectivity for CDK over a range of other protein kinases (IC50>1000 nM). Purvalanol B inhibits the growth a chloroquine-resistant strain of P. falciparum. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||