2222067-23-2
Chemical Structure
Neuraminidase-IN-13
- CAS No.: 2222067-23-2
- Formula:C13H13F7N4O7
- Molecular Weight:470.25
IUPAC Name: (2R,3R,4S)-4-azido-3-(2,2,3,3,4,4,4-heptafluorobutanamido)-2-((1R,2R)-1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid
InChIKey: QFKZKDOBWVGERZ-LRGKAINGSA-N
SMILES: FC(F)(F)C(F)(F)C(F)(F)C(N[C@H]1[C@](OC(C(O)=O)=C[C@@H]1N=[N+]=[N-])([H])[C@H](O)[C@H](O)CO)=O
Biological Activity: Neuraminidase-IN-13 (Compound 10) is a neuraminidase inhibitor with antiviral activity and low cytotoxicity. Neuraminidase-IN-13 significantly inhibits NDV infection of Vero cells by preventing the release of viral particles from infected cells[1]. Neuraminidase-IN-13 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neuraminidase-IN-13 | Neuraminidase-IN-13 (Compound 10) is a neuraminidase inhibitor with antiviral activity and low cytotoxicity. Neuraminidase-IN-13 significantly inhibits NDV infection of Vero cells by preventing the release of viral particles from infected cells. Neuraminidase-IN-13 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
