234081-96-0
Chemical Structure
10-(tert-Butoxy)-10-oxodecanoic acid
- CAS No.: 234081-96-0
- Formula:C14H26O4
- Molecular Weight:258.35
IUPAC Name: 10-(tert-butoxy)-10-oxodecanoic acid
InChIKey: FRIYHISQFBWFCN-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)CCCCCCCCC(O)=O
Biological Activity: 10-(tert-Butoxy)-10-oxodecanoic acid is a short linker featuring a carboxylic acid and a tert-butyl ester. Carboxylic acids can be linked with alcohols or amines, while the tert-butyl ester can be selectively deprotected to allow for reactivity as a carboxylic acid to form esters or amides.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
10-(tert-Butoxy)-10-oxodecanoic acid | 98.0% | 10-(tert-Butoxy)-10-oxodecanoic acid is a short linker featuring a carboxylic acid and a tert-butyl ester. Carboxylic acids can be linked with alcohols or amines, while the tert-butyl ester can be selectively deprotected to allow for reactivity as a carboxylic acid to form esters or amides. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||