2616-72-0
Chemical Structure
Naphthol AS-TR phosphate
- CAS No.: 2616-72-0
- Formula:C18H15ClNO5P
- Molecular Weight:391.74
IUPAC Name: 3-((4-chloro-2-methylphenyl)carbamoyl)naphthalen-2-yl dihydrogen phosphate
InChIKey: SHTFMUPUBYXPCD-UHFFFAOYSA-N
SMILES: O=C(C1=C(OP(O)(O)=O)C=C2C=CC=CC2=C1)NC3=CC=C(Cl)C=C3C
Biological Activity: Naphthol AS-TR Phosphate is a water-soluble dye commonly used as an enzyme substrate in various biochemical assays to detect alkaline phosphatase activity. Naphthol AS-TR Phosphate has unique chemical properties that allow it to be hydrolyzed by alkaline phosphatase to form a colored product that can be detected spectrophotometrically. This makes it a useful tool for monitoring enzyme activity in biological samples such as serum or urine.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Naphthol AS-TR phosphate | Naphthol AS-TR Phosphate is a water-soluble dye commonly used as an enzyme substrate in various biochemical assays to detect alkaline phosphatase activity. Naphthol AS-TR Phosphate has unique chemical properties that allow it to be hydrolyzed by alkaline phosphatase to form a colored product that can be detected spectrophotometrically. This makes it a useful tool for monitoring enzyme activity in biological samples such as serum or urine. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
