410074-75-8
Chemical Structure
DOV-102,677
- CAS No.: 410074-75-8
- Formula:C11H11Cl2N
- Molecular Weight:228.12
IUPAC Name: (1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane
InChIKey: BSMNRYCSBFHEMQ-GZMMTYOYSA-N
SMILES: ClC1=CC=C([C@@]23CNC[C@]2([H])C3)C=C1Cl
Biological Activity: DOV-102,677 is an orally sctive triple monoamine neurotransmitter reuptake inhibitor that simultaneously inhibits the dopamine (DAT) (IC50 = 129 nM; Ki = 222 nM), norepinephrine (NET) (IC50 = 103 nM; Ki = 1030 nM), and serotonin (SERT) (IC50 = 133 nM; Ki = 740 nM) transporters. DOV-102,677 demonstrated significant antidepressant-like activity and sensory-motor gating regulatory effects in mouse experiments. DOV-102,677 can be used for research on depression[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DOV-102,677 | DOV-102,677 is an orally sctive triple monoamine neurotransmitter reuptake inhibitor that simultaneously inhibits the dopamine (DAT) (IC50 = 129 nM; Ki = 222 nM), norepinephrine (NET) (IC50 = 103 nM; Ki = 1030 nM), and serotonin (SERT) (IC50 = 133 nM; Ki = 740 nM) transporters. DOV-102,677 demonstrated significant antidepressant-like activity and sensory-motor gating regulatory effects in mouse experiments. DOV-102,677 can be used for research on depression. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||