4494-26-2
Chemical Structure
5-Formyl-2'-deoxyuridine
- CAS No.: 4494-26-2
- Formula:C10H12N2O6
- Molecular Weight:256.21
IUPAC Name: 1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde
InChIKey: MVORBLZUGBSUNB-XLPZGREQSA-N
SMILES: OC[C@@H]1[C@@H](O)C[C@H](N2C=C(C=O)C(NC2=O)=O)O1
Biological Activity: 5-Formyl-2'-deoxyuridine is a product formed when the 5-methyl group of thymine in DNA undergoes oxidation due to exposure to gamma radiation or certain chemical agents. Serving as a biomarker of oxidative DNA damage, 5-formyl-2'-deoxyuridine is employed in investigations of DNA damage and repair mechanisms. Additionally, 5-Formyl-2'-deoxyuridine can be used in studies involving chemically crosslinking with peptides derived from the RecA protein[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Formyl-2'-deoxyuridine | 99.64% | 5-Formyl-2'-deoxyuridine is a product formed when the 5-methyl group of thymine in DNA undergoes oxidation due to exposure to gamma radiation or certain chemical agents. Serving as a biomarker of oxidative DNA damage, 5-formyl-2'-deoxyuridine is employed in investigations of DNA damage and repair mechanisms. Additionally, 5-Formyl-2'-deoxyuridine can be used in studies involving chemically crosslinking with peptides derived from the RecA protein. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||