524-70-9
Chemical Structure
S-Adenosyl-L-ethionine
- CAS No.: 524-70-9
- Formula:C16H24N6O5S
- Molecular Weight:412.46
InChIKey: UBQZUBPODLPCFG-PIBDHAAFSA-N
SMILES: NC1=C(N=C2)C(N2[C@@H]3O[C@H](C[S+](CC)CC[C@H](N)C([O-])=O)[C@@H](O)[C@H]3O)=NC=N1
Biological Activity: S-Adenosyl-L-ethionine is S-Adenosyl-L-methione analog. S-Adenosyl-L-ethionine is able to replace S-Adenosyl-L-methione during HydG catalysis. HydG can utilize S-Adenosyl-L-ethionine as an effective alternative cosubstrate to S-Adenosyl-L-methione under normal enzymatic turnover conditions, producing the Ω intermediate and allowing efficient catalytic turnover of substrate L-tyrosine[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
S-Adenosyl-L-ethionine | 99.95% | S-Adenosyl-L-ethionine is S-Adenosyl-L-methione analog. S-Adenosyl-L-ethionine is able to replace S-Adenosyl-L-methione during HydG catalysis. HydG can utilize S-Adenosyl-L-ethionine as an effective alternative cosubstrate to S-Adenosyl-L-methione under normal enzymatic turnover conditions, producing the Ω intermediate and allowing efficient catalytic turnover of substrate L-tyrosine. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||