81-88-9
Chemical Structure
Rhodamine B
Synonym(s): Basic Violet 10; Brilliant Pink B; Rhodamine O; Tetraethylrhodamine
- CAS No.: 81-88-9
- Formula:C28H31ClN2O3
- Molecular Weight:479.01
IUPAC Name: 9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthylium chloride
InChIKey: PYWVYCXTNDRMGF-UHFFFAOYSA-N
SMILES: CCN(C1=CC2=[O+]C3=C(C=CC(N(CC)CC)=C3)C(C4=CC=CC=C4C(O)=O)=C2C=C1)CC.[Cl-]
Biological Activity: Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents (Ex/Em = 546/610 nm).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine B | 98.94% | Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents (Ex/Em = 546/610 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B (Standard) | 96.16% | Rhodamine B (Standard) is the analytical standard of Rhodamine B. This product is intended for research and analytical applications. Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B (solution) | Rhodamine B (solution) is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents. Solvent and concentration: DMSO: 10 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||