81-88-9
81-88-9
Chemical Structure
Rhodamine B
Synonym(s): Basic Violet 10; Brilliant Pink B; Rhodamine O; Tetraethylrhodamine
- CAS No.: 81-88-9
- Formula:C28H31ClN2O3
- Molecular Weight:479.01
IUPAC Name: 9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthylium chloride
InChIKey: PYWVYCXTNDRMGF-UHFFFAOYSA-N
SMILES: CCN(C1=CC2=[O+]C3=C(C=CC(N(CC)CC)=C3)C(C4=CC=CC=C4C(O)=O)=C2C=C1)CC.[Cl-]
Biological Activity: Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents (Ex/Em = 546/610 nm).
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine B | 98.94% | Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents (Ex/Em = 546/610 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B (Standard) | 96.16% | Rhodamine B (Standard) is the analytical standard of Rhodamine B. This product is intended for research and analytical applications. Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B (solution) | Rhodamine B (solution) is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and agents. Solvent and concentration: DMSO: 10 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B isothiocyanate | 95.73% | Rhodamine B isothiocyanate (RBITC) is a fluorescent dye commonly used in biological imaging and labeling applications. It has an isothiocyanate functional group that can be covalently attached to amino groups on proteins and other biomolecules, making it useful for fluorescent labeling of cells and tissues. RBITC fluoresces bright orange-red under green light excitation, which makes it easy to detect and track labeled molecules in complex samples. Due to its stability and sensitivity, RBITC has been widely used in various research fields, including cell biology, immunology, and neurobiology. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B ethyl ester | Rhodamine B ethyl ester is a hydrophilic cationic derivative of Rhodamine B (HY-Y0016), belonging to non-selective cytotoxic agents and transporters. Rhodamine B ethyl ester exhibits broad-spectrum in vitro cytotoxicity and exerts cytotoxic effects on human tumor cells. Rhodamine B ethyl ester binds effectively to lipid membranes, undergoes voltage-dependent transport across planar bilayer phosphatidylcholine membranes, and its transport can be determined by current relaxation after voltage jump. Rhodamine B ethyl ester can be used in research related to cancers such as epithelioid melanoma and colorectal adenocarcinoma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4,5-Diamino-N,N,N',N'-tetraethyl-rhodamin | 4,5-Diamino-N,N,N',N'-tetraethyl-rhodamin is a multifunctional dye. Dyes are important tools in biological experiments. They can help researchers observe and analyze cell structures, track biomolecules, evaluate cell functions, distinguish cell types, detect biomolecules, study tissue pathology and monitor microorganisms. Their applications range from basic scientific research to clinical A wide range of diagnostics. Dyes are also widely used in traditional fields such as textile dyeing, as well as in emerging fields such as functional textile processing, food pigments and dye-sensitized solar cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5,6-Diamino-N,N,N',N'-tetraethyl-rhodamin | 5,6-Diamino-N,N,N',N'-tetraethyl-rhodamin is a fluorescent indicator for NO. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine 110 | 99.81% | Rhodamine 110 is a sensitive and selective substrate for assaying proteinases in solution or inside living cells. The excitation wavelength is 498 nm and the emission wavelength is 521 nm. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
TMRM | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine 3B perchlorate | 98.60% | Rhodamine 3B perchlorate is a laser dye, | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B hexyl ester perchlorate | 96.96% | Rhodamine B hexyl ester perchlorate is a cell-permeant, orange-fluorescent dye for mitochondria. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine B NHS ester | 99.87% | Rhodamine B NHS ester (N-Hydroxysuccinimidyl rhodamine B ester) is an amine-reactive fluorescent probe (λex/λem: 564/589 nm, respectively). Rhodamine B NHS ester could react with Glycine (HY-Y0966). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Octadecyl Rhodamine B chloride | 98.67% | Octadecyl Rhodamine B chloride is an amphiphilic fluorescent probe with both membrane-binding ability and fluorescent properties, which easily forms aggregates in aqueous phase leading to self-quenching. Octadecyl Rhodamine B chloride can be used for cell membrane staining and further applied in membrane biology research. The maximum absorption/emission wavelengths of Octadecyl Rhodamine B chloride monomer in Triton X-100 are 565 nm/585 nm; the absorption peaks of aggregates in water are blue-shifted to 524 nm and 574 nm, with significantly quenched fluorescence. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
