845-46-5
Chemical Structure
Dabcyl acid sodium
Synonym(s): DABCYL sodium; Para-methyl red sodium
- CAS No.: 845-46-5
- Formula:C15H14N3NaO2
- Molecular Weight:291.28
IUPAC Name: sodium (E)-4-((4-(dimethylamino)phenyl)diazenyl)benzoate
InChIKey: OSCKRHPYZNTEIO-CMBBICFISA-M
SMILES: O=C(C1=CC=C(C=C1)/N=N/C2=CC=C(N(C)C)C=C2)O[Na]
Biological Activity: Dabcyl acid sodium (DABCYL sodium) is a nonfluorescent chromophore and a quencher. Dabcyl acid sodium can be used as molecular beacon nucleic acid probes to recognize and report the presence of specific nucleic acids in homogeneous solutions[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dabcyl acid sodium | Dabcyl acid sodium (DABCYL sodium) is a nonfluorescent chromophore and a quencher. Dabcyl acid sodium can be used as molecular beacon nucleic acid probes to recognize and report the presence of specific nucleic acids in homogeneous solutions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords