869725-27-9
Chemical Structure
CCR5 antagonist 5
- CAS No.: 869725-27-9
- Formula:C30H42Cl2F3N5O2
- Molecular Weight:632.59
IUPAC Name: (4,6-dimethylpyrimidin-5-yl)(4-((S)-4-((1R,2R)-2-ethoxy-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl)-3-methylpiperazin-1-yl)-4-methylpiperidin-1-yl)methanone
InChIKey: IXVIZEPNBCSFFE-XLXXGMJUSA-N
SMILES: FC(F)(F)C1=CC2=C([C@@H](N3CCN(C4(C)CCN(C(C5=C(C)N=CN=C5C)=O)CC4)C[C@@H]3C)[C@H](OCC)C2)C=C1.Cl.Cl
Biological Activity: CCR5 antagonist 5 (compound example 11) is a CCR5 antagonist. CCR5 antagonist 5 has the potential to study inflammation and immunity and viral (such as HIV) infection[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CCR5 antagonist 5 | CCR5 antagonist 5 (compound example 11) is a CCR5 antagonist. CCR5 antagonist 5 has the potential to study inflammation and immunity and viral (such as HIV) infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||