875313-64-7
Chemical Structure
Dimethyl lithospermate B
Synonym(s): dmLSB
- CAS No.: 875313-64-7
- Formula:C38H34O16
- Molecular Weight:746.67
IUPAC Name: (R)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl (2S,3S)-2-(3,4-dihydroxyphenyl)-4-((E)-3-(((R)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl)oxy)-3-oxoprop-1-en-1-yl)-7-hydroxy-2,3-dihydrobenzofuran-3-carboxylate
InChIKey: DHYLGBJCEGEBGQ-QHIXFNMVSA-N
SMILES: OC1=C(O)C=CC(C[C@H](C(OC)=O)OC([C@H]2C3=C(/C=C/C(O[C@@H](C(OC)=O)CC4=CC(O)=C(O)C=C4)=O)C=CC(O)=C3O[C@@H]2C5=CC(O)=C(O)C=C5)=O)=C1
Biological Activity: Dimethyl lithospermate B (dmLSB) is a selective Na+ channel agonist. Dimethyl lithospermate B slows inactivation of sodium current (INa), leading to increased inward current during the early phases of the action potential (AP)[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dimethyl lithospermate B | 99.40% | Dimethyl lithospermate B (dmLSB) is a selective Na+ channel agonist. Dimethyl lithospermate B slows inactivation of sodium current (INa), leading to increased inward current during the early phases of the action potential (AP). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Fish JM, et al. Dimethyl lithospermate B, an extract of Danshen, suppresses arrhythmogenesis associated with the Brugada syndrome. Circulation. 2006 Mar 21;113(11):1393-400. [Content Brief]
- [2]. Yoon JY, et al. A novel Na+ channel agonist, dimethyl lithospermate B, slows Na+ current inactivation and increases action potential duration in isolated rat ventricular myocytes. Br J Pharmacol. 2004 Nov;143(6):765-73. [Content Brief]
Keywords
