87976-26-9
Chemical Structure
Phthalic acid-d4
- CAS No.: 87976-26-9
- Formula:C8H2D4O4
- Molecular Weight:170.16
IUPAC Name: phthalic-3,4,5,6-d4 acid
InChIKey: XNGIFLGASWRNHJ-RHQRLBAQSA-N
SMILES: OC(C1=C(C([2H])=C([2H])C([2H])=C1[2H])C(O)=O)=O
Biological Activity: Phthalic acid-d4 is the deuterium labeled Phthalic acid. Phthalic acid is the final common metabolite of phthalic acid esters (PAEs). Phthalic acid can be used for the synthesis of synthetic agents, such as isophthalic acid (IPA), and terephthalic acid (TPA). Phthalic acid has applications in the preparation of phthalate ester plasticizers. Phthalic acid exhibits mutagenic effect and causes genetic damage in mammalian germ cells[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phthalic acid-d4 | 98.36% | Phthalic acid-d4 is the deuterium labeled Phthalic acid. Phthalic acid is the final common metabolite of phthalic acid esters (PAEs). Phthalic acid can be used for the synthesis of synthetic agents, such as isophthalic acid (IPA), and terephthalic acid (TPA). Phthalic acid has applications in the preparation of phthalate ester plasticizers. Phthalic acid exhibits mutagenic effect and causes genetic damage in mammalian germ cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phthalic acid (Standard) | ≥98% | Phthalic acid (Standard) is the analytical standard of Phthalic acid. This product is intended for research and analytical applications. Phthalic acid is the final common metabolite of phthalic acid esters (PAEs). Phthalic acid can be used for the synthesis of synthetic agents, such as isophthalic acid (IPA), and terephthalic acid (TPA). Phthalic acid has applications in the preparation of phthalate ester plasticizers. Phthalic acid exhibits mutagenic effect and causes genetic damage in mammalian germ cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phthalic acid-13C | Phthalic acid-13C is the 13C-labeled Phthalic acid. Phthalic acid is the final common metabolite of phthalic acid esters (PAEs). Phthalic acid can be used for the synthesis of synthetic agents, such as isophthalic acid (IPA), and terephthalic acid (TPA). Phthalic acid has applications in the preparation of phthalate ester plasticizers. Phthalic acid exhibits mutagenic effect and causes genetic damage in mammalian germ cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phthalic acid | 99.94% | Phthalic acid is the final common metabolite of phthalic acid esters (PAEs). Phthalic acid can be used for the synthesis of synthetic agents, such as isophthalic acid (IPA), and terephthalic acid (TPA). Phthalic acid has applications in the preparation of phthalate ester plasticizers. Phthalic acid exhibits mutagenic effect and causes genetic damage in mammalian germ cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
