989-38-8
Chemical Structure
Rhodamine 6G
Synonym(s): Basic Red 1
- CAS No.: 989-38-8
- Formula:C28H31ClN2O3
- Molecular Weight:479.01
IUPAC Name: 9-(2-(ethoxycarbonyl)phenyl)-3,6-bis(ethylamino)-2,7-dimethylxanthylium chloride
InChIKey: XFKVYXCRNATCOO-UHFFFAOYSA-M
SMILES: CC1=CC2=C(C3=CC=CC=C3C(OCC)=O)C4=C([O+]=C2C=C1NCC)C=C(NCC)C(C)=C4.[Cl-]
Biological Activity: Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine 6G | 98.02% | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rhodamine 6G (Standard) | 96.44% | Rhodamine 6G (Standard) is the analytical standard of Rhodamine 6G. This product is intended for research and analytical applications. Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||