1002801-51-5
Chemical Structure
TH10785
- CAS No.: 1002801-51-5
- Formula:C17H21N3
- Molecular Weight:267.37
IUPAC Name: N-cyclohexyl-2-cyclopropylquinazolin-4-amine
InChIKey: ZQMGQZOHIDOPCQ-UHFFFAOYSA-N
SMILES: C1(N=C(C2CC2)N=C3NC4CCCCC4)=C3C=CC=C1
Biological Activity: TH10785 is a DNA glycosylase 1 (OGG1) activator, TH10785 can interact with the phenylalanine-319 and glycine-42 amino acids of OGG1 and increase the enzyme activity, generates β, δ-lyase enzymatic function. TH10785 can control the catalytic activity mediated by a nitrogen base within its molecular structure. TH10785 can be used for the research of various diseases and aging connected with DNA oxidative lesions[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TH10785 | 99.93% | TH10785 is a DNA glycosylase 1 (OGG1) activator, TH10785 can interact with the phenylalanine-319 and glycine-42 amino acids of OGG1 and increase the enzyme activity, generates β, δ-lyase enzymatic function. TH10785 can control the catalytic activity mediated by a nitrogen base within its molecular structure. TH10785 can be used for the research of various diseases and aging connected with DNA oxidative lesions. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||