1006061-57-9
Chemical Structure
1-(Azidomethyl)pyrene
- CAS No.: 1006061-57-9
- Formula:C17H11N3
- Molecular Weight:257.29
IUPAC Name: 1-(azidomethyl)pyrene
InChIKey: WLKXPQFZTSRGHP-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCC1=C(C2=C34)C=CC4=CC=CC3=CC=C2C=C1
Biological Activity: 1-(Azidomethyl)pyrene is a fluorescent dye[1]. 1-(Azidomethyl)pyrene is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1-(Azidomethyl)pyrene | 1-(Azidomethyl)pyrene is a fluorescent dye. 1-(Azidomethyl)pyrene is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||