1021184-77-9
Chemical Structure
Fulvotomentoside B
- CAS No.: 1021184-77-9
- Formula:C57H92O25
- Molecular Weight:1177.33
InChIKey: BTUYGUFIIUIODG-IUEFZHLPSA-N
SMILES: O[C@H]([C@H]([C@@H](CO1)O)O)[C@@H]1OC[C@H]([C@H]([C@@H]([C@H]2O)O)O)O[C@H]2OC([C@]34[C@](CC(C)(CC4)C)([H])C5=CC[C@@]([C@@]6([C@@]([C@@](C)([C@H](CC6)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)CO)([H])CC%10)C)([H])[C@]%10(C)[C@@]5(CC3)C)=O
Biological Activity: Fulvotomentoside B is a saponin isolated from Lactobacillus flavus. Fulvotomentoside compounds can significantly reduce serum glutamate pyruvate transaminase (SGPT) and triacylglycerol (GT) levels in mice poisoned by CCl4, d-galactosamine (d-gal) and acetaminophen, and significantly alleviate liver pathology. damage[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Fulvotomentoside B | Fulvotomentoside B is a saponin isolated from Lactobacillus flavus. Fulvotomentoside compounds can significantly reduce serum glutamate pyruvate transaminase (SGPT) and triacylglycerol (GT) levels in mice poisoned by CCl4, d-galactosamine (d-gal) and acetaminophen, and significantly alleviate liver pathology. damage. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||