1025023-05-5
Chemical Structure
Periglaucine B
Synonym(s): (+)-Periglaucine B
- CAS No.: 1025023-05-5
- Formula:C20H23NO6
- Molecular Weight:373.40
IUPAC Name: (3S,4R,4aS,6S,11bS)-3,4-dimethoxy-14-methyl-3,4,5,6-tetrahydro-4a,11b-(epiminoethano)-4,6-epoxyphenanthro[2,3-d][1,3]dioxol-2(1H)-one
InChIKey: QJDYNQYLCIPODD-HVTWWXFQSA-N
SMILES: CO[C@]1(O[C@@]([H])(C2)C3=CC4=C(OCO4)C=C3[C@@](CC5=O)(CC6)[C@]12N6C)[C@H]5OC
Biological Activity: Periglaucine B ((+)-Periglaucine B) is an alkaloid and an HBsAg inhibitor. Periglaucine B can be isolated from Pericampylus glaucus. Periglaucine B inhibits the secretion of hepatitis B virus (HBV) surface antigen (HBsAg) in Hep G2.2.15 cells with an IC50 of 0.47 mM[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Periglaucine B | Periglaucine B ((+)-Periglaucine B) is an alkaloid and an HBsAg inhibitor. Periglaucine B can be isolated from Pericampylus glaucus. Periglaucine B inhibits the secretion of hepatitis B virus (HBV) surface antigen (HBsAg) in Hep G2.2.15 cells with an IC50 of 0.47 mM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||