10318-16-8
Chemical Structure
Chloramphenicol 3-acetate
- CAS. Nr.: 10318-16-8
- Formula:C13H14Cl2N2O6
- Molecular Weight:365.17
IUPAC Name: (2R,3R)-2-(2,2-dichloroacetamido)-3-hydroxy-3-(4-nitrophenyl)propyl acetate
InChIKey: VVOIFRARHIZCJD-GHMZBOCLSA-N
SMILES: O=C(N[C@H](COC(C)=O)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1)C(Cl)Cl
Biological Activity: Chloramphenicol 3-acetate is the main intermediate in the biodegradation of CAP, formed by the acetylation of the 3-hydroxy group of CAP through chloramphenicol acetyltransferase, this is a common resistance mechanism that microbes have against chloramphenicol[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chloramphenicol 3-acetate | 98.97% | Chloramphenicol 3-acetate is the main intermediate in the biodegradation of CAP, formed by the acetylation of the 3-hydroxy group of CAP through chloramphenicol acetyltransferase, this is a common resistance mechanism that microbes have against chloramphenicol. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords