1062-96-0
Chemical Structure
Cholesterol hexanoate
- CAS No.: 1062-96-0
- Formula:C33H56O2
- Molecular Weight:484.80
IUPAC Name: (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-((R)-6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl hexanoate
InChIKey: FPBODWXATDKICU-FLFWOSPYSA-N
SMILES: CCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1
Biological Activity: Cholesterol hexanoate is an organic compound belonging to the class of esters. It is formed from the reaction between cholesterol and caproic acid. Cholesterol hexanoate has several applications in the pharmaceutical industry, particularly as a bioactive compound with potential research potential for improving a range of medical conditions, such as high cholesterol and inflammation-related diseases. Additionally, it has potential applications as a food additive to improve texture and stability.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cholesterol hexanoate | Cholesterol hexanoate is an organic compound belonging to the class of esters. It is formed from the reaction between cholesterol and caproic acid. Cholesterol hexanoate has several applications in the pharmaceutical industry, particularly as a bioactive compound with potential research potential for improving a range of medical conditions, such as high cholesterol and inflammation-related diseases. Additionally, it has potential applications as a food additive to improve texture and stability. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
