110880-53-0
Chemical Structure
[MePhe7]-Neurokinin B
- CAS No.: 110880-53-0
- Formula:C60H81N13O14S2
- Molecular Weight:1272.49
InChIKey: FWEMQPXASKKIMV-UILVTTEASA-N
SMILES: CC(C[C@H](NC(CNC([C@@H](N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](N)CC(O)=O)=O)CCSC)=O)CC1=CN=CN1)=O)CC(O)=O)=O)CC2=CC=CC=C2)=O)CC3=CC=CC=C3)=O)C)CC4=CC=CC=C4)=O)=O)C(N[C@H](C(N)=O)CCSC)=O)C
Biological Activity: [MePhe7]-Neurokinin B is an neurokinin NK-3 receptor (NK3R) agonist with an IC50 value of 3 nM. [MePhe7]-Neurokinin B is a potential regulator of pulsatile gonadotropin-releasing hormone (GnRH) secretion via activation of the neurokinin-3 receptor (NK3R)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
[MePhe7]-Neurokinin B | 98.76% | [MePhe7]-Neurokinin B is an neurokinin NK-3 receptor (NK3R) agonist with an IC50 value of 3 nM. [MePhe7]-Neurokinin B is a potential regulator of pulsatile gonadotropin-releasing hormone (GnRH) secretion via activation of the neurokinin-3 receptor (NK3R). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||