1120364-53-5
Chemical Structure
Br-Boc-C2-azido
- CAS No.: 1120364-53-5
- Formula:C6H10BrN3O2
- Molecular Weight:236.07
IUPAC Name: 2-azidoethyl 2-bromo-2-methylpropanoate
InChIKey: OYSXPOJKJKBNSG-UHFFFAOYSA-N
SMILES: CC(C)(Br)C(OCCN=[N+]=[N-])=O
Biological Activity: Br-Boc-C2-azido is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Br-Boc-C2-azido is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Br-Boc-C2-azido | Br-Boc-C2-azido is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs. Br-Boc-C2-azido is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||