114562-40-2
Chemical Structure
Ferrocin B
- CAS No.: 114562-40-2
- Formula:C51H82FeN13O20
- Molecular Weight:1253.12
InChIKey: CCTVUVZJIBDVRM-UEIGIMKUSA-N
SMILES: O=C1OCC(C(NC2C(NCC(NC(C(C)C)C(NC(CO)C(NC3C(NC(CO)C(NCC(NC(CCCN4[O-][Fe+3]56(O=C(C)N(CCC2)[O-]5)(O=C(C)N(CCC3)[O-]6)O=C4C)C(NC1)=O)=O)=O)=O)=O)=O)=O)=O)=O)NC(C/C=C/CCCCCC)=O
Biological Activity: Ferrocin B is an iron-containing cyclic decapeptide antibiotic found in the bacterium Pseudomonas fluorescens YK-310, exhibiting strong antibacterial activity primarily against Gram-negative bacteria, with particularly potent inhibitory effects on Pseudomonas aeruginosa. In a mouse infection model, Ferrocin B shows a half effective dose (ED50) of 0.593 mg/kg against P. aeruginosa. Ferrocin B holds potential for research in the field of anti-infective therapies[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ferrocin B | Ferrocin B is an iron-containing cyclic decapeptide antibiotic found in the bacterium Pseudomonas fluorescens YK-310, exhibiting strong antibacterial activity primarily against Gram-negative bacteria, with particularly potent inhibitory effects on Pseudomonas aeruginosa. In a mouse infection model, Ferrocin B shows a half effective dose (ED50) of 0.593 mg/kg against P. aeruginosa. Ferrocin B holds potential for research in the field of anti-infective therapies. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords