1189955-53-0
Chemical Structure
Phenanthrene-13C6
- CAS No.: 1189955-53-0
- Formula:C813C6H10
- Molecular Weight:184.19
InChIKey: YNPNZTXNASCQKK-KHNBPAKNSA-N
SMILES: [13C]12=C3C(C=CC=C3)=CC=[13C]1[13CH]=[13CH][13CH]=[13CH]2
Biological Activity: Phenanthrene-13C6 is the 13C labeled Phenanthrene (HY-B1727). Phenanthrene is an orally active polycyclic aromatic hydrocarbon (PAH) that induces inflammation, oxidative stress, and apoptosis. Additionally, phenanthrene is commonly used to detect or assess PAH pollution in the environment[1][2][3][4].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phenanthrene-13C6 | 99.9% | Phenanthrene-13C6 is the 13C labeled Phenanthrene (HY-B1727). Phenanthrene is an orally active polycyclic aromatic hydrocarbon (PAH) that induces inflammation, oxidative stress, and apoptosis. Additionally, phenanthrene is commonly used to detect or assess PAH pollution in the environment. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenanthrene (Standard) | 99.57% | Phenanthrene (Standard) is the analytical standard of Phenanthrene. This product is intended for research and analytical applications. Phenanthrene is an orally active polycyclic aromatic hydrocarbon (PAH) that induces inflammation, oxidative stress, and apoptosis. Additionally, phenanthrene is commonly used to detect or assess PAH pollution in the environment. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenanthrene-13C2 | Phenanthrene-13C2 is the 13C-labeled Phenanthrene (HY-B1727). Phenanthrene is an orally active polycyclic aromatic hydrocarbon (PAH) that induces inflammation, oxidative stress, and apoptosis. Additionally, phenanthrene is commonly used to detect or assess PAH pollution in the environment. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenanthrene-d10 | 99.46% | Phenanthrene-d10 is the deuterium labeled Phenanthrene. Phenanthrene is a polycyclic aromatic hydrocarbon (PAH) and has been frequently used as an indicator for monitoring PAH contaminated matrices. Phenanthrene induces oxidative stress and inflammation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenanthrene | 99.82% | Phenanthrene is an orally active polycyclic aromatic hydrocarbon (PAH) that induces inflammation, oxidative stress, and apoptosis. Additionally, phenanthrene is commonly used to detect or assess PAH pollution in the environment. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||