119-24-4
Chemical Structure
Pteroic acid
- CAS No.: 119-24-4
- Formula:C14H12N6O3
- Molecular Weight:312.29
IUPAC Name: 4-(((2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)amino)benzoic acid
InChIKey: JOAQINSXLLMRCV-UHFFFAOYSA-N
SMILES: OC(C1=CC=C(NCC2=NC3=C(N=C2)N=C(N)NC3=O)C=C1)=O
Biological Activity: Pteroic acid is a precursor to significant compounds like Folic acid (HY-16637) and Vitamin B12 (HY-B0315). Pteroic acid facilitates the examination of how different compounds influence cell growth and development[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pteroic acid | 98.05% | Pteroic acid is a precursor to significant compounds like Folic acid (HY-16637) and Vitamin B12 (HY-B0315). Pteroic acid facilitates the examination of how different compounds influence cell growth and development. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pteroic acid (Standard) | ≥98% | Pteroic acid (Standard) is the analytical standard of Pteroic acid (HY-79139). This product is intended for research and analytical applications. Pteroic acid is a precursor to significant compounds like Folic acid (HY-16637) and Vitamin B12 (HY-B0315). Pteroic acid facilitates the examination of how different compounds influence cell growth and development. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Vickers PJ, et al. Activation of folypolyglutamate synthetase by pteroic acid. Can J Biochem Cell Biol. 1985 Jul;63(7):777-9. [Content Brief]
- [2]. Ke CY, et al. Targeting the tumor-associated folate receptor with an 111In-DTPA conjugate of pteroic acid. J Am Chem Soc. 2005;127(20):7421-7426. [Content Brief]