1192802-98-4
Chemical Structure
UV Cleavable Biotin-PEG2-Azide
- CAS No.: 1192802-98-4
- Formula:C38H51N7O9S
- Molecular Weight:781.92
IUPAC Name: 1-(3-((2,13-dioxo-17-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-6,9-dioxa-3,12-diazaheptadecyl)oxy)phenyl)-2-oxo-2-phenylethyl 6-azidohexanoate
InChIKey: JHYKDGNZEADRIH-ZPIGJYFOSA-N
SMILES: O=C(OC(C1=CC=CC(OCC(NCCOCCOCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O)=O)=C1)C(C4=CC=CC=C4)=O)CCCCCN=[N+]=[N-]
Biological Activity: UV Cleavable Biotin-PEG2-Azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. UV Cleavable Biotin-PEG2-Azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
UV Cleavable Biotin-PEG2-Azide | 95.58% | UV Cleavable Biotin-PEG2-Azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. UV Cleavable Biotin-PEG2-Azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||