1214319-92-2
Chemical Structure
Azido-PEG8-acid
- CAS No.: 1214319-92-2
- Formula:C19H37N3O10
- Molecular Weight:467.51
IUPAC Name: 1-azido-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid
InChIKey: URUGOEBULOZLBF-UHFFFAOYSA-N
SMILES: O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG8-acid is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG8-acid is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG8-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG8-acid | 98.0% | Azido-PEG8-acid is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG8-acid is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||