123313-59-7
Chemical Structure
Ajugamacrin B
- CAS No.: 123313-59-7
- Formula:C31H44O11
- Molecular Weight:592.67
InChIKey: JPFTWOXTEMZXOG-JKZOSZDYSA-N
SMILES: CC(OC[C@]12[C@]3(CC[C@H]([C@]1([H])[C@](C)([C@@H](C[C@@H]2OC(C)=O)C)C[C@@H](C(CO4)=CC4=O)OC([C@@H](C)CC)=O)OC(C)=O)CO3)=O
Biological Activity: Ajugamacrin B is a new clerodane-type diterpenoid that interferes with the feeding behavior of fifth-instar larvae of Spodoptera littoralis. Ajugamacrin B is promising for research related to pest control[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ajugamacrin B | Ajugamacrin B is a new clerodane-type diterpenoid that interferes with the feeding behavior of fifth-instar larvae of Spodoptera littoralis. Ajugamacrin B is promising for research related to pest control. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||