1260001-87-3
Chemical Structure
Benzyl-PEG2-azide
- CAS No.: 1260001-87-3
- Formula:C11H15N3O2
- Molecular Weight:221.26
IUPAC Name: ((2-(2-azidoethoxy)ethoxy)methyl)benzene
InChIKey: MMTGEJWEROOVON-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCC1=CC=CC=C1
Biological Activity: Benzyl-PEG2-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Benzyl-PEG2-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Benzyl-PEG2-azide | 99.12% | Benzyl-PEG2-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Benzyl-PEG2-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||