1278520-08-3
Chemical Structure
Cochliomycin B
- CAS No.: 1278520-08-3
- Formula:C22H28O7
- Molecular Weight:404.45
SMILES: O=C1C2=C(O)C=C(OC)C=C2/C=C/C[C@@](OC(C)(C)O3)([H])[C@@]3([H])[C@@H](O)/C=C/C[C@H](C)O1
Biological Activity: Cochliomycin B is a natural product that can be isolated from Gorgonian-Derived Fungus Cochliobolus lunatus[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cochliomycin B | Cochliomycin B is a natural product that can be isolated from Gorgonian-Derived Fungus Cochliobolus lunatus. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||