1333154-77-0
Chemical Structure
Azido-PEG7-amine
- CAS No.: 1333154-77-0
- Formula:C16H34N4O7
- Molecular Weight:394.46
IUPAC Name: 23-azido-3,6,9,12,15,18,21-heptaoxatricosan-1-amine
InChIKey: VZKXLNRXAFTBOW-UHFFFAOYSA-N
SMILES: NCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG7-amine is a non-cleavable 7 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG7-amine is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG7-amine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG7-amine | 99.93% | Azido-PEG7-amine is a non-cleavable 7 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG7-amine is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG7-amine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||