1334159-03-3
Chemical Structure
DC-peptoid-1
- CAS No.: 1334159-03-3
- Formula:C39H70N10O8
- Molecular Weight:807.04
InChIKey: QVTZINOFTGGCNQ-UHFFFAOYSA-N
SMILES: COCCN(C(CN(C(CN(C(CNCC(C)C)=O)CCC1=CC=C(C=C1)O)=O)CCCCN)=O)CC(N(CC(N(CC(N)=O)CCCCN)=O)CCCCN)=O
Biological Activity:
DC-peptoid-1 is a specific binder and crosslinker targeting the phosphorylated Brd4 PDID domain, with a dissociation constant (Kd) of approximately 50-100 μM for human-derived targets. DC-peptoid-1 only binds to phosphorylated PDID and fails to recognize the non-phosphorylated form or other domains (such as Brd4 598-785). DC-peptoid-1 effectively crosslinks with the target protein both in solution and cell lysates. It can successfully capture phosphorylated PDID from complex systems via immobilization, without binding to bacterial-derived non-phosphorylated proteins or other non-specific phosphoproteins. DC-peptoid-1 has the potential to serve as a phosphoprotein-specific antibody substitute for applications such as immunoaffinity purification[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DC-peptoid-1 | DC-peptoid-1 is a specific binder and crosslinker targeting the phosphorylated Brd4 PDID domain, with a dissociation constant (Kd) of approximately 50-100 μM for human-derived targets. DC-peptoid-1 only binds to phosphorylated PDID and fails to recognize the non-phosphorylated form or other domains (such as Brd4 598-785). DC-peptoid-1 effectively crosslinks with the target protein both in solution and cell lysates. It can successfully capture phosphorylated PDID from complex systems via immobilization, without binding to bacterial-derived non-phosphorylated proteins or other non-specific phosphoproteins. DC-peptoid-1 has the potential to serve as a phosphoprotein-specific antibody substitute for applications such as immunoaffinity purification. |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
