1339202-33-3
Chemical Structure
Diazo Biotin-PEG3-azide
- CAS No.: 1339202-33-3
- Formula:C33H45N9O7S
- Molecular Weight:711.83
IUPAC Name: 4-((E)-(5-(2-azidoethyl)-2-hydroxyphenyl)diazenyl)-N-(13-oxo-17-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-3,6,9-trioxa-12-azaheptadecyl)benzamide
InChIKey: VQJUOWXTLWKWGJ-GKVYSXGOSA-N
SMILES: O=C(NCCOCCOCCOCCNC(C1=CC=C(/N=N/C2=CC(CCN=[N+]=[N-])=CC=C2O)C=C1)=O)CCCC[C@@H]3SC[C@]([C@]3([H])N4)([H])NC4=O
Biological Activity: Diazo Biotin-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Diazo Biotin-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Diazo Biotin-PEG3-azide | 95.46% | Diazo Biotin-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Diazo Biotin-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
