1357078-03-5
Chemical Structure
Coumarin boronic acid
- CAS No.: 1357078-03-5
- Formula:C9H7BO4
- Molecular Weight:189.96
IUPAC Name: (2-oxo-2H-chromen-7-yl)boronic acid
InChIKey: MUZVCJQIBNTECF-UHFFFAOYSA-N
SMILES: O=C(O1)C=CC2=C1C=C(B(O)O)C=C2
Biological Activity: Coumarin boronic acid is a fluorescent probe. The excitation and emission wavelengths of coumarin boronic acid are set to 360 nm and 430 nm, respectively. Coumarin boronic acid can be used to monitor the formation of amino acid and protein hydroxyl peroxides in real time, which is beneficial for understanding the mechanisms of oxidative stress and protein post-translational modification[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Coumarin boronic acid | 99.93% | Coumarin boronic acid is a fluorescent probe. The excitation and emission wavelengths of coumarin boronic acid are set to 360 nm and 430 nm, respectively. Coumarin boronic acid can be used to monitor the formation of amino acid and protein hydroxyl peroxides in real time, which is beneficial for understanding the mechanisms of oxidative stress and protein post-translational modification. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||