1366240-73-4
Chemical Structure
MDK0734
- CAS No.: 1366240-73-4
- Formula:C15H17N3O2
- Molecular Weight:271.31
IUPAC Name: 8-(4-methylpiperidin-1-yl)-5-nitroquinoline
InChIKey: ABDSNJJYMMKJBF-UHFFFAOYSA-N
SMILES: O=[N+]([O-])C1=C2C=CC=NC2=C(C=C1)N3CCC(CC3)C
Biological Activity: MDK0734 is a selective inhibitor that inhibits feline hepsin B endopeptidase and exopeptidase activities. MDK0734 demonstrated efficacy in a cell-based in vitro tumor invasion model, significantly attenuating the invasive ability of MCF-10A neoT cells. MDK0734 provides new potential inhibitors for the development of clinically useful compounds targeting the deleterious effects of feline hepsin B in cancer progression[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MDK0734 | MDK0734 is a selective inhibitor that inhibits feline hepsin B endopeptidase and exopeptidase activities. MDK0734 demonstrated efficacy in a cell-based in vitro tumor invasion model, significantly attenuating the invasive ability of MCF-10A neoT cells. MDK0734 provides new potential inhibitors for the development of clinically useful compounds targeting the deleterious effects of feline hepsin B in cancer progression. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
