1375224-56-8
Chemical Structure
Panowamycin B
- CAS No.: 1375224-56-8
- Formula:C17H26O3
- Molecular Weight:278.39
SMILES: OCC[C@@H]1C2=CC(C)=CC=C2[C@@H]([C@](O1)([H])[C@H](C)[C@@H](O)C)C
Biological Activity: Panowamycin B is an isochroman compound that can be produced by Streptomyces sp. K07-0010. Panowamycin B exhibits antitrypanosomal activity against the Trypanosoma brucei brucei GUTat 3.1 strain (IC50: 3.30 μg/mL). Panowamycin B shows weak cytotoxicity towards human fetal lung fibroblast MRC-5 cells (IC50: 13 μg/mL). Panowamycin B can be used for research in the field of antitrypanosomal studies[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Panowamycin B | Panowamycin B is an isochroman compound that can be produced by Streptomyces sp. K07-0010. Panowamycin B exhibits antitrypanosomal activity against the Trypanosoma brucei brucei GUTat 3.1 strain (IC50: 3.30 μg/mL). Panowamycin B shows weak cytotoxicity towards human fetal lung fibroblast MRC-5 cells (IC50: 13 μg/mL). Panowamycin B can be used for research in the field of antitrypanosomal studies. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||