1383544-71-5
Chemical Structure
AZD-CO-C2-Ph-amido-Ph-azide
- CAS No.: 1383544-71-5
- Formula:C19H17N5O3
- Molecular Weight:363.37
IUPAC Name: 4-azido-N-(4-(3-oxo-3-(2-oxoazetidin-1-yl)propyl)phenyl)benzamide
InChIKey: ZGNPLPRYBYXYMB-UHFFFAOYSA-N
SMILES: O=C(C1=CC=C(C=C1)N=[N+]=[N-])NC2=CC=C(C=C2)CCC(N3CCC3=O)=O
Biological Activity: AZD-CO-C2-Ph-amido-Ph-azide is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. AZD-CO-C2-Ph-amido-Ph-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AZD-CO-C2-Ph-amido-Ph-azide | AZD-CO-C2-Ph-amido-Ph-azide is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. AZD-CO-C2-Ph-amido-Ph-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||