1392495-07-6
Chemical Structure
Aspergillumarin B
- CAS No.: 1392495-07-6
- Formula:C14H18O4
- Molecular Weight:250.29
SMILES: OC1=C2C(C[C@@H](CCC[C@H](C)O)OC2=O)=CC=C1
Biological Activity: Aspergillumarin B (Compound 2) is a derivative of dihydroisocoumarin. Aspergillumarin B can be isolated from the endophytic fungus Aspergillus sp.. Aspergillumarin B has a weak antibacterial activity against Staphylococcus aureus and Bacillus subtilis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aspergillumarin B | Aspergillumarin B (Compound 2) is a derivative of dihydroisocoumarin. Aspergillumarin B can be isolated from the endophytic fungus Aspergillus sp.. Aspergillumarin B has a weak antibacterial activity against Staphylococcus aureus and Bacillus subtilis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||