141360-89-6
Chemical Structure
Polyporusterone B
- CAS No.: 141360-89-6
- Formula:C28H44O6
- Molecular Weight:476.65
IUPAC Name: (2S,3R,5R,9R,10R,13R,14S,17S)-17-((2R,3R)-2,3-dihydroxy-6-methyl-5-methyleneheptan-2-yl)-2,3,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one
InChIKey: OQDKHYZVFZGSRC-DWJOQFFMSA-N
SMILES: C=C(C(C)C)C[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC([C@]4([H])C[C@@H](O)[C@@H](O)C[C@]4(C)[C@@]3([H])CC[C@]12C)=O
Biological Activity: Polyporusterone B is a triterpene carboxylic acid isolated from Polyporus umbellatus Fries. Polyporusterone B has inhibitory effect on free radical-induced lysis of red blood cells (hemolysis)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Polyporusterone B | 99.24% | Polyporusterone B is a triterpene carboxylic acid isolated from Polyporus umbellatus Fries. Polyporusterone B has inhibitory effect on free radical-induced lysis of red blood cells (hemolysis). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||