1421783-42-7
Chemical Structure
Azido-PEG10-azide
- CAS No.: 1421783-42-7
- Formula:C22H44N6O10
- Molecular Weight:552.62
IUPAC Name: 1,32-diazido-3,6,9,12,15,18,21,24,27,30-decaoxadotriacontane
InChIKey: NLHKJEYZBGTRDB-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG10-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG10-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG10-azide | Azido-PEG10-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG10-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||