143601-09-6
Chemical Structure
Curculigoside B
- CAS No.: 143601-09-6
- Formula:C21H24O11
- Molecular Weight:452.41
IUPAC Name: 5-hydroxy-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzyl 2-hydroxy-6-methoxybenzoate
InChIKey: DIZYHORWVKHYCQ-PEVLUNPASA-N
SMILES: O=C(C(C(O)=CC=C1)=C1OC)OCC(C=C2O)=C(C=C2)O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]([C@H]3O)CO
Biological Activity: Curculigoside B, a phenolic glycoside isolated from Curculigo orchioides, enhances the osteoblast proliferation, decreases the area of bone resorption pit, osteoclastic formation and TRAP activity. Antiosteoporotic and antioxidative activities[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Curculigoside B | 99.92% | Curculigoside B, a phenolic glycoside isolated from Curculigo orchioides, enhances the osteoblast proliferation, decreases the area of bone resorption pit, osteoclastic formation and TRAP activity. Antiosteoporotic and antioxidative activities. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||