1446240-77-2
Chemical Structure
BODIPY 540 (purity 99%)
- CAS No.: 1446240-77-2
- Formula:C24H27BF2I2N2
- Molecular Weight:646.10
InChIKey: OVVKCKCYLBXFIA-UHFFFAOYSA-N
SMILES: [F-][B+3]1([N]2=C(C)C(CC)=C(C)C2=C(C3=C(C)C(CC)=C(C)[N-]31)C4=CC(I)=C(C)C(I)=C4)[F-]
Biological Activity: BODIPY 540 (purity>98%) is a BODIPY dye.BODIPY dye is a small molecule dye with strong UV absorption ability.Its fluorescence peak is relatively sharp, its quantum yield is high, and it is relatively insensitive to the polarity and pH value of the environment.BODIPY 540 (purity>98%) has a purity higher than 98% and is suitable for cell experiments (Ex/Em = 540/580 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BODIPY 540 (purity 99%) | 99.29% | BODIPY 540 (purity>98%) is a BODIPY dye.BODIPY dye is a small molecule dye with strong UV absorption ability.Its fluorescence peak is relatively sharp, its quantum yield is high, and it is relatively insensitive to the polarity and pH value of the environment.BODIPY 540 (purity>98%) has a purity higher than 98% and is suitable for cell experiments (Ex/Em = 540/580 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||