1452396-11-0
Chemical Structure
Sartorypyrone B
- CAS No.: 1452396-11-0
- Formula:C30H42O7
- Molecular Weight:514.65
IUPAC Name: (2R,3S,4aR,4bR,6aS,12aS,12bR,14aR)-1,1,4a,6a,9,12b-hexamethyl-11-oxo-2,3,4,4a,4b,5,6,6a,12,12a,12b,13,14,14a-tetradecahydro-1H,11H-naphtho[2,1-f]pyrano[2,3-b]chromene-2,3-diyl diacetate
InChIKey: DFAVZYUGRTVMCA-KNUPVKMWSA-N
SMILES: C[C@@]([C@]1([H])C(C)([C@H]2OC(C)=O)C)(C[C@@H]2OC(C)=O)[C@](CC[C@@]34C)([H])[C@]([C@]3([H])CC(C5=O)=C(OC(C)=C5)O4)(CC1)C
Biological Activity: Sartorypyrone B is a 2β-acetoxyl analogue of chevalone C. Sartorypyrone B is yielded from the ethyl acetate extract of the culture of the marine sponge-associated fungus Neosartorya tsunodae (KUFC 9213). Sartorypyrone B exhibits strong growth inhibitory activity, having GI50s of 17.8, 20.5, and 25.0 μM, respectively, for MCF-7, NCI-H460, and A375-C5. Sartorypyrone B has the potential for the research of breast adenocarcinoma, non-small cell lung cancer, and melanoma diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sartorypyrone B | Sartorypyrone B is a 2β-acetoxyl analogue of chevalone C. Sartorypyrone B is yielded from the ethyl acetate extract of the culture of the marine sponge-associated fungus Neosartorya tsunodae (KUFC 9213). Sartorypyrone B exhibits strong growth inhibitory activity, having GI50s of 17.8, 20.5, and 25.0 μM, respectively, for MCF-7, NCI-H460, and A375-C5. Sartorypyrone B has the potential for the research of breast adenocarcinoma, non-small cell lung cancer, and melanoma diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
