14930-96-2
14930-96-2
Chemical Structure
Cytochalasin B
Synonym(s): Phomin
- CAS No.: 14930-96-2
- Formula:C29H37NO5
- Molecular Weight:479.61
IUPAC Name: (3E,5R,9R,11E,12aS,13S,15S,15aS,16S,18aS)-16-benzyl-5,13-dihydroxy-9,15-dimethyl-14-methylene-6,7,8,9,10,12a,13,14,15,15a,16,17-dodecahydro-2H-[1]oxacyclotetradecino[2,3-d]isoindole-2,18(5H)-dione
InChIKey: GBOGMAARMMDZGR-TYHYBEHESA-N
SMILES: O=C1N[C@@H](CC2=CC=CC=C2)[C@@]3([H])[C@]14[C@](/C=C/C[C@H](C)CCC[C@@H](O)/C=C/C(O4)=O)([H])[C@H](O)C([C@H]3C)=C
Biological Activity: Cytochalasin B is a cell-permeable mycotoxin binding to the barbed end of actin filaments, disrupting the formation of actin polymers, with Kd value of 1.4-2.2 nM for F-actin. Cytochalasin B blocks cell migration.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cytochalasin B | 99.41% | Cytochalasin B is a cell-permeable mycotoxin binding to the barbed end of actin filaments, disrupting the formation of actin polymers, with Kd value of 1.4-2.2 nM for F-actin. Cytochalasin B blocks cell migration. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin B (Standard) | ≥98% | (R)-Duloxetine (Standard) is the analytical standard of (R)-Duloxetine. This product is intended for research and analytical applications. (R)-Duloxetine is a form of Duloxetine (HY-B0161) that causes tonic and usage-dependent impairment of neuronal Na+ channels. (R)-Duloxetine can be used in pain research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin J | Cytochalasin J is a cytochalasin detivative. Cytochalasin J affects mitotic spindel microtubule organization and kinetochore structure, and exhibits cytotoxicity in human leukemia K562 cell with IC50 of 1.5 μM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin H | 99.40% | Cytochalasin H is a nature product that could be isolated from fungus Phomopsis sp. Cytochalasin H inhibits cell growth and induces apoptosis. Cytochalasin H has anti-angiogenic activity. Cytochalasin H is an antibiotic and has antibacterial activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rosellichalasin | Rosellichalasin is an antibacterial agent isolated from the endophytic fungus Aspergillus flavipes Y-62. Rosellichalasin exhibits antibacterial activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin Z2 | Cytochalasin Z2 is a 24-oxa-cytochalasan. Cytochalasin Z2 is isolated from wheat cultures of Pyrenophora semeniperda. Cytochalasin Z2 shows no activity in root elongation assays of wheat and tomato seedlings. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
10-Phenyl-[12]-cytochalasins Z16 | 10-Phenyl--cytochalasins Z16 (Compounds 5) is a cytochalasin that inhibits wheat root elongation with an IC50 of 17.35 μM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin F | Cytochalasin F has many biological activities, such as inhibiting cytoKinesis reversibly, inhibiting megasophil endocytosis and exocytosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin M | Cytochalasin M has many biological activities, such as inhibiting cytoKinesis reversibly, inhibiting megasophil endocytosis and exocytosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dihydrocytochalasin B | 99.9% | Dihydrocytochalasin B is an Actin disruptor. Dihydrocytochalasin B disrupts actin microfilament bundles, inhibits actin polymerization, and alters intracellular actin cytoskeletal structures. Dihydrocytochalasin B blocks the initiation of DNA synthesis. Dihydrocytochalasin B inhibits Calcium transport. Dihydrocytochalasin B inhibits cytokinesis and alters cell morphology. Dihydrocytochalasin B can be used in studies related to rickets. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cytochalasin A | 99.76% | Cytochalasin A is a cell-permeable fungal toxin that is an oxidized derivative of cytochalasin B. Cytochalasin A is an inhibitor of HIV-1 protease (IC50=3 μM) and inhibits actin polymerization and interferes with microtubule assembly by reacting with sulfhydryl groups. Antibiotic and fungicidal activitives. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
