149838-22-2
Chemical Structure
FM1-43
- CAS No.: 149838-22-2
- Formula:C30H49Br2N3
- Molecular Weight:611.54
IUPAC Name: 2-amino-N-(7-methoxy-8-(3-(morpholino-d8)propoxy)-2,3-dihydroimidazo[1,2-c]quinazolin-5-yl)pyrimidine-5-carboxamide
InChIKey: VZUVCAGXYLMFEC-UHFFFAOYSA-L
SMILES: CC[N+](CC)(CC)CCC[N+](C=C1)=CC=C1/C=C/C2=CC=C(N(CCCC)CCCC)C=C2.[Br-].[Br-]
Biological Activity: FM1-43 is a very lipophilic, water-soluble styrene dyes, can specifically bind to cell membranes and inner membrane organelles to produce fluorescence. FM1-43 is widely used in endocytic and exospic membrane structure markers.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FM1-43 | 99.85% | FM1-43 is a very lipophilic, water-soluble styrene dyes, can specifically bind to cell membranes and inner membrane organelles to produce fluorescence. FM1-43 is widely used in endocytic and exospic membrane structure markers. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
FM1-43 (solution) | FM1-43 (solution) is a very lipophilic, water-soluble styrene dyes, can specifically bind to cell membranes and inner membrane organelles to produce fluorescence. FM1-43 is widely used in endocytic and exospic membrane structure markers. Solvent and concentration: DMSO: 10 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||