150907-52-1
Chemical Structure
2,4-D-13C6
Synonym(s): 2,4-Dichlorophenoxyacetic acid-13C6
- CAS No.: 150907-52-1
- Formula:C213C6H6Cl2O3
- Molecular Weight:226.99
IUPAC Name: 2-(2,4-dichlorophenoxy-1,2,3,4,5,6-13C6)acetic acid
InChIKey: OVSKIKFHRZPJSS-JTZKEMBVSA-N
SMILES: OC(CO[13C]1=[13C]([13CH]=[13C]([13CH]=[13CH]1)Cl)Cl)=O
Biological Activity: 2,4-D-13C6 is the 13C-labeled 2,4-D (HY-18572). 2,4-D (2,4-Dichlorophenoxyacetic acid) is a selective systemic herbicide for the control of broad-leaved weeds. 2,4-D acts as a plant hormone, causing uncontrolled growth in the meristematic tissues. 2,4-D inhibits DNA and protein synthesis and thereby prevents normal plant growth and development[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2,4-D-13C6 | 95.89% | 2,4-D-13C6 is the 13C-labeled 2,4-D (HY-18572). 2,4-D (2,4-Dichlorophenoxyacetic acid) is a selective systemic herbicide for the control of broad-leaved weeds. 2,4-D acts as a plant hormone, causing uncontrolled growth in the meristematic tissues. 2,4-D inhibits DNA and protein synthesis and thereby prevents normal plant growth and development. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2,4-D (Standard) | 99.89% | 2,4-D (Standard) is the analytical standard of 2,4-D (HY-18572). This product is intended for research and analytical applications. 2,4-D (2, 4-dichlorophenoxyacetic acid) is a selective herbicide that can be used for the control of broad-leaved weeds. 2,4-D can induce apoptosis. 2,4-D inhibits DNA and protein synthesis, thereby preventing normal plant growth and development. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2,4-D-d3 | 2,4-D-d3 is the deuterium labeled 2,4-D (HY-18572). 2,4-D (2,4-Dichlorophenoxyacetic acid) is a selective systemic herbicide for the control of broad-leaved weeds. 2,4-D acts as a plant hormone, causing uncontrolled growth in the meristematic tissues. 2,4-D inhibits DNA and protein synthesis and thereby prevents normal plant growth and development. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2,4-D-d5 | 99.48% | 2,4-D-d5 (2,4-Dichlorophenoxyacetic acid-d5) is the deuterium labeled 2,4-D (HY-18572). 2,4-D (2,4-Dichlorophenoxyacetic acid) is a selective systemic herbicide for the control of broad-leaved weeds. 2,4-D acts as a plant hormone, causing uncontrolled growth in the meristematic tissues. 2,4-D inhibits DNA and protein synthesis and thereby prevents normal plant growth and development. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2,4-D | 99.86% | 2,4-D (2, 4-dichlorophenoxyacetic acid) is a selective herbicide that can be used for the control of broad-leaved weeds. 2,4-D can induce apoptosis. 2,4-D inhibits DNA and protein synthesis, thereby preventing normal plant growth and development. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||