1620523-64-9
Chemical Structure
Azide-C2-SS-C2-biotin
- CAS No.: 1620523-64-9
- Formula:C14H24N6O2S3
- Molecular Weight:404.57
IUPAC Name: N-(2-((2-azidoethyl)disulfanyl)ethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide
InChIKey: CMWHTSPPRPEKSH-GVXVVHGQSA-N
SMILES: O=C(NCCSSCCN=[N+]=[N-])CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O
Biological Activity: Azide-C2-SS-C2-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azide-C2-SS-C2-biotin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-C2-SS-C2-biotin | 99.84% | Azide-C2-SS-C2-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azide-C2-SS-C2-biotin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||