1638745-27-3
Chemical Structure
BODIPY-cholesterol conjugate-3
- CAS. Nr.: 1638745-27-3
- Formula:C48H53BF2N2OS
- Molecular Weight:754.82
InChIKey: PAJQBTMBXYTUFX-HHXANIPKSA-N
SMILES: [F-][B+3]1([N-]2C(C(C3=CC=CC=C3)=C4[N]1=CC(C5=CC=C(CC[C@@H](C)[C@]6([H])[C@](CC[C@@]7([H])C8CC=C9[C@]7(C)CC[C@H](O)C9)(C)[C@@]8([H])CC6)C=C5)=C4)=CC(C%10=CC=CS%10)=C2)[F-]
Biological Activity: BODIPY-cholesterol conjugate-3 (compound 7) is a cholesterol analogue with a fluorescent BODIPY group. BODIPY-cholesterol conjugate-3 can be used to simultaneously visualize multiple cholesterol pools in cells, as it is primarily localized to the plasma membrane[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BODIPY-cholesterol conjugate-3 | BODIPY-cholesterol conjugate-3 (compound 7) is a cholesterol analogue with a fluorescent BODIPY group. BODIPY-cholesterol conjugate-3 can be used to simultaneously visualize multiple cholesterol pools in cells, as it is primarily localized to the plasma membrane. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||