168640-82-2
Chemical Structure
Azide-PEG4-Tos
- CAS No.: 168640-82-2
- Formula:C15H23N3O6S
- Molecular Weight:373.42
IUPAC Name: 2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate
InChIKey: ZYZZLMAEZYMGEU-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOS(C1=CC=C(C)C=C1)(=O)=O
Biological Activity: Azide-PEG4-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG4-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-PEG4-Tos | 99.59% | Azide-PEG4-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG4-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||