169211-45-4
Chemical Structure
DiSBAC10
- CAS No.: 169211-45-4
- Formula:C51H88N4O4S2
- Molecular Weight:885.40
IUPAC Name: (E)-1,3-didecyl-5-(3-(1,3-didecyl-4,6-dioxo-2-thioxohexahydropyrimidin-5-yl)allylidene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione
InChIKey: PXRLNZXPUUPVIB-HEFFKOSUSA-N
SMILES: O=C1/C(C(N(CCCCCCCCCC)C(N1CCCCCCCCCC)=S)=O)=C\C=C\C2C(N(CCCCCCCCCC)C(N(CCCCCCCCCC)C2=O)=S)=O
Biological Activity: DiSBAC10 is a voltage-sensitive fluorescent probe used to study cell membrane electrical activity in FRET assays. In a resting polarized cell, DiSBAC10 resides on the outer leaflet of the membrane where it accepts photons from excited fluorescein-labeled proteins and re-emits the photons at a higher wavelength. Depolarization of the cell causes rapid translocation of DiSBAC10 to the inner leaflet of the membrane, thereby increasing the distance between fluorophores and reducing the FRET signal.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DiSBAC10 | DiSBAC10 is a voltage-sensitive fluorescent probe used to study cell membrane electrical activity in FRET assays. In a resting polarized cell, DiSBAC10 resides on the outer leaflet of the membrane where it accepts photons from excited fluorescein-labeled proteins and re-emits the photons at a higher wavelength. Depolarization of the cell causes rapid translocation of DiSBAC10 to the inner leaflet of the membrane, thereby increasing the distance between fluorophores and reducing the FRET signal. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||