1702356-19-1
Chemical Structure
BCN-PEG4-NHS ester
- CAS No.: 1702356-19-1
- Formula:C26H38N2O10
- Molecular Weight:538.59
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 1-((1R,8S,9s)-bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azanonadecan-19-oate
InChIKey: MFQCOKMBYCIQEJ-KOUNCHBCSA-N
SMILES: [H][C@@]12[C@@](CCC#CCC2)([H])[C@@H]1COC(NCCOCCOCCOCCOCCC(ON3C(CCC3=O)=O)=O)=O
Biological Activity: BCN-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. BCN-PEG4-NHS ester is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BCN-PEG4-NHS ester | 95.0% | BCN-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. BCN-PEG4-NHS ester is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
BCN-endo-PEG4-NHS | 96.75% | BCN-endo-PEG4-NHS is an ADC Linker containing 4 PEG units. BCN-endo-PEG4-NHS contains the lyophilic bidentate macrocyclic ligand endo-BCN, which allows for further synthesis of macrocyclic complexes. In click chemistry, endo-BCN can react with molecules containing azide groups to form stable triazoles in the absence of catalysts. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||